A7604958
Methyl-β-D-galactopyranoside , 10mMinDMSO , 1824-94-8
Synonym(s):
Methyl β-D -galactoside
CAS NO.:1824-94-8
Empirical Formula: C7H14O6
Molecular Weight: 194.18
MDL number: MFCD00064357
EINECS: 217-361-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-180 °C |
| Boiling point: | 250.62°C (rough estimate) |
| Density | 1.47 |
| refractive index | -16.5 ° (C=1.5, MeOH) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Crystalline Powder |
| pka | 12.92±0.70(Predicted) |
| color | White |
| Water Solubility | Soluble in water and methanol. |
| BRN | 81569 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4+,5+,6-,7-/s3 |
| InChIKey | HOVAGTYPODGVJG-CHUHMKGRNA-N |
| SMILES | C([C@@H]1[C@@H]([C@H](O)[C@@H](O)[C@H](OC)O1)O)O |&1:1,2,3,5,7,r| |
| CAS DataBase Reference | 1824-94-8(CAS DataBase Reference) |
Description and Uses
It is a weak substrate and effective inducer of beta-D-galactosidase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |






