A3940412
Ellagic acid , 96% , 476-66-4
Synonym(s):
4,4?,5,5?,6,6?-Hexahydroxydiphenic Acid 2,6,2?,6?-Dilactone, TBBD, PRMT Inhibitor II;4,4′,5,5′,6,6′-Hexahydroxydiphenic acid 2,6,2′,6′-dilactone;Alizarin Yellow;Benzoaric acid;Elagostasine
CAS NO.:476-66-4
Empirical Formula: C14H6O8
Molecular Weight: 302.19
MDL number: MFCD00006914
EINECS: 207-508-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB157.60 | In Stock |
|
| 100G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥350 °C |
| Boiling point: | 363.24°C (rough estimate) |
| Density | 1.667 |
| refractive index | 1.5800 (estimate) |
| storage temp. | 2-8°C |
| solubility | 1 M NaOH: 10 mg/mL, dark green |
| form | powder |
| pka | 5.02±0.20(Predicted) |
| color | tan to gray |
| biological source | tree bark |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| Sensitive | Air & Light Sensitive |
| Merck | 14,3547 |
| BRN | 47549 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H |
| InChIKey | AFSDNFLWKVMVRB-UHFFFAOYSA-N |
| SMILES | Oc1cc2C(=O)Oc3c(O)c(O)cc4C(=O)Oc(c1O)c2-c34 |
| LogP | 0.239 (est) |
| CAS DataBase Reference | 476-66-4(CAS DataBase Reference) |
| EPA Substance Registry System | Ellagic acid (476-66-4) |
Description and Uses
Ellagic Acid is a phenol antioxidant found naturally in various fruits and vegetables. Ellagic Acid was shown to exhibit high levels of hemostatic, antineoplastic, antimutagenic, antiproliferative and antioxidant properties in studies, which suggests its potential health benefits following ellagic acid consumption.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| RTECS | DJ2620000 |
| F | 8-10-23 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 476-66-4(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: > 20gm/kg |





