A7609658
L-Selenomethionine , 10mMinWater , 3211-76-5
Synonym(s):
(S)-2-Amino-4-(methylseleno)butyric acid;Seleno-L -methionine
CAS NO.:3211-76-5
Empirical Formula: C5H11NO2Se
Molecular Weight: 196.11
MDL number: MFCD00037210
EINECS: 608-705-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265 °C |
| alpha | 18 º (c=1, 1N HCl) |
| Boiling point: | 320.8±37.0 °C(Predicted) |
| refractive index | 18 ° (C=0.5, 2mol/L HCl) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| pka | 2.26±0.10(Predicted) |
| color | white to off-white |
| Water Solubility | soluble |
| Merck | 14,8441 |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | RJFAYQIBOAGBLC-BYPYZUCNSA-N |
| SMILES | C(O)(=O)[C@@H](N)CC[Se]C |
| LogP | 0.152 (est) |
| CAS DataBase Reference | 3211-76-5(CAS DataBase Reference) |
Description and Uses
L-Selenomethionine has been used:
- in toxicity studies in Japanese Medaka embryos
- to study its effects on selenium status indicators in pregnant long-tailed macaques (Macaca Fascicularis)
- to label proteins for single wavelength anomalous dispersion (SAD) phasing
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H373-H410 |
| Precautionary statements | P260-P301+P330+P331+P310-P304+P340+P311-P403+P233 |
| Hazard Codes | T,N |
| Risk Statements | 23/25-33-50/53 |
| Safety Statements | 20/21-28-45-60-61-28A |
| RIDADR | UN 3283 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | EK7713840 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |







