A7622158
5-Hydroxy-L-tryptophan , 10mMinDMSO , 4350-09-8
Synonym(s):
L -2-Amino-3-(5-hydroxyindolyl)propionic acid;L -5-HTP;5-Hydroxy-L-tryptophan - CAS 895096 - Calbiochem;L-5-HTP
CAS NO.：4350-09-8
Empirical Formula: C11H12N2O3
Molecular Weight: 220.22
MDL number: MFCD00064341
EINECS: 224-411-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270 °C (dec.) (lit.) |
| alpha | -32.5 º (c=1,H2O on dry basis) |
| Boiling point: | 361.16°C (rough estimate) |
| Density | 0.902 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 175 °F |
| storage temp. | 2-8°C |
| solubility | H2O: 10 mg/mL |
| form | solid |
| pka | 2.22±0.10(Predicted) |
| color | white |
| optical activity | [α]22/D 30°, c = 1 in H2O |
| Water Solubility | Slightly soluble |
| Merck | 14,4847 |
| BRN | 88200 |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | LDCYZAJDBXYCGN-VIFPVBQESA-N |
| SMILES | N[C@@H](Cc1c[nH]c2ccc(O)cc12)C(O)=O |
| LogP | -0.140 (est) |
| CAS DataBase Reference | 4350-09-8(CAS DataBase Reference) |
| EPA Substance Registry System | L-5-Hydroxytryptophan (4350-09-8) |
Description and Uses
5-Hydroxy-L-Tryptophan is a hydroxylated metabolite of L-Tryptophan
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-65-20/21/22-20/21 |
| Safety Statements | 36-26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | YN7110000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
