PRODUCT Properties
| Melting point: | 230-231 °C (lit.) |
| Boiling point: | 307.35°C (rough estimate) |
| Density | 1.3844 (rough estimate) |
| refractive index | 1.4717 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO : 250 mg/mL (1200.94 mM; Need ultrasonic) |
| pka | 7.22±0.20(Predicted) |
| form | Solid |
| color | White |
| Merck | 13,4288 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H8O5/c1-14-6-4-5-2-3-7(11)15-10(5)9(13)8(6)12/h2-4,12-13H,1H3 |
| InChIKey | HAVWRBANWNTOJX-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=C(O)C(O)=C(OC)C=C2C=C1 |
| LogP | 0.590 (est) |
| CAS DataBase Reference | 574-84-5(CAS DataBase Reference) |
Description and Uses
Fraxetin is a coumarin compound with anti-oxidant and anti-inflammatory activity. Also acts as a protective agent against hyperuricemia and renal dysfunction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29322090 |






