A7627858
Geniposidicacid , 10mMinDMSO , 27741-01-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C(Solv: methanol (67-56-1)) |
| Boiling point: | 684.1±55.0 °C(Predicted) |
| Density | 1+-.0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF:30.0(Max Conc. mg/mL);80.14(Max Conc. mM) DMSO:48.67(Max Conc. mg/mL);130.01(Max Conc. mM) |
| form | powder |
| pka | 4.49±0.60(Predicted) |
| color | White |
| InChIKey | ZJDOESGVOWAULF-OVSXCSOGNA-N |
| SMILES | [C@@]12([H])C(CO)=CC[C@]1([H])C(C(=O)O)=CO[C@H]2O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,7,15,17,18,20,21,23,r| |
Description and Uses
Geniposidic acid is an effective anticancer and radioprotection agent. Geniposidic acid might be a more potent tumor growth inhibitor than geniposide (GP) when combined with the X-irradiation, though there was no significant synergetic effect on their com
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





