A7629558
PhenelzineSulfate , 10mMinDMSO , 156-51-4
Synonym(s):
Phenelzine hydrogen sulphate;Phenelzine sulfate salt
CAS NO.：156-51-4
Empirical Formula: C8H14N2O4S
Molecular Weight: 234.27
MDL number: MFCD00050687
EINECS: 205-856-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166.5-167.5 °C |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water; practically insoluble in ethanol (96%) and in ether . |
| form | A solid |
| color | White to off-white |
| biological source | synthetic |
| Water Solubility | water: 50mg/mL, clear to slightly hazy, colorless to faintly yellow |
| Merck | 13,7300 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C8H12N2.H2O4S/c9-10-7-6-8-4-2-1-3-5-8;1-5(2,3)4/h1-5,10H,6-7,9H2;(H2,1,2,3,4) |
| InChIKey | RXBKMJIPNDOHFR-UHFFFAOYSA-N |
| SMILES | C1(CCNN)C=CC=CC=1.S(=O)(=O)(O)O |
| CAS DataBase Reference | 156-51-4 |
| IARC | 3 (Vol. 24, Sup 7) 1987 |
Description and Uses
antihistaminic
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MV8750000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2928002500 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 orally in mice: 156 mg/kg (Gylys) |
