A7630058
Imidazole-4-aceticAcidHydrochloride , 10mMinDMSO , 3251-69-2
Synonym(s):
(4-Imidazolyl)acetic acid hydrochloride;I4AA
CAS NO.:3251-69-2
Empirical Formula: C5H7ClN2O2
Molecular Weight: 162.57
MDL number: MFCD00012698
EINECS: 221-840-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-222 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble100mg/mL, clear, faintly yellow |
| form | Crystalline Powder |
| color | White to light yellow |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3701591 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H6N2O2.ClH/c8-5(9)1-4-2-6-3-7-4;/h2-3H,1H2,(H,6,7)(H,8,9);1H |
| InChIKey | MWHLCFYPFGFBQO-UHFFFAOYSA-N |
| SMILES | C1(CC(=O)O)N=CNC=1.Cl |
| CAS DataBase Reference | 3251-69-2(CAS DataBase Reference) |
Description and Uses
4-Imidazoleacetic acid hydrochloride was used in the synthesis of:
- imidazolyl-polyethylenimine modified nanoparticles
- pyridyl and imidazoyl functionalized carboproteins, potential metal ion chelators
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 22-24/25-36/37/39-27-26-37/39 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |




![2-(Imidazo[1,2-a]pyridin-2-yl)aceticacid](https://img.chemicalbook.com/CAS/GIF/19741-30-1.gif)
