A7630512
D-(+)-Trehalose dihydrate , Analysis standard , 6138-23-4
Synonym(s):
α,α-Trehalose;α-D -Glucopyranosyl-α-D -glucopyranoside;D -(+)-Trehalose dihydrate;1-O-α-D-Glucopyranosyl-α-D-glucopyranoside;1-O-alpha-D-Glucopyranosyl-alpha-D-glucopyranoside
CAS NO.:6138-23-4
Empirical Formula: C12H22O11·2H2O
Molecular Weight: 378.33
MDL number: MFCD00071594
EINECS: 612-140-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-99 °C(lit.) |
| alpha | 179 º (c=2, H2O) |
| Boiling point: | 115.3 °C |
| FEMA | 4600 | TREHALOSE, DIHYDRATE |
| refractive index | 181 ° (C=7, H2O) |
| storage temp. | room temp |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | White to Off-White |
| biological source | Saccharomyces cerevisiae |
| optical activity | [α]20/D +179±3°, c = 2% in H2O |
| Water Solubility | 68.9 g/100 mL (20 ºC) |
| Sensitive | Hygroscopic |
| Merck | 14,9580 |
| BRN | 5322018 |
| InChI | 1S/C12H22O11.2H2O/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12;;/h3-20H,1-2H2;2*1H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-;;/m1../s1 |
| InChIKey | DPVHGFAJLZWDOC-NYAOJISMSA-N |
| SMILES | [H]O[H].[H]O[H].OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference | 6138-23-4(CAS DataBase Reference) |
Description and Uses
Trehalose is a natural non-reducing disaccharide composed of two α-glucose units. It is found in all major groups of organisms except vertebrates, has biological functions as an osmolyte, storage reserve, and stress protectant, and has diverse commercial applications. Trehalose can also induce or enhance autophagy.
Stabilizes cells during freezing, freeze-drying and air-drying. Sweetener and stabilizer in foods; cryoprotectant for freeze-dried foods. Additive in cosmetics and personal care products.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 38-36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 2 |
| RTECS | LZ5776547 |
| F | 3-10 |
| TSCA | Yes |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |





