A8437712
L-(-)-Xylose , 97% , 609-06-3
CAS NO.:609-06-3
Empirical Formula: C5H10O5
Molecular Weight: 150.13
MDL number: MFCD00151096
EINECS: 210-174-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB37.60 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB256.80 | In Stock |
|
| 100G | RMB894.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-152 °C(lit.) |
| Boiling point: | 191.65°C (rough estimate) |
| Density | 1.525 |
| refractive index | -20 ° (C=10, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | 12.46±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]24/D 18.7°, c = 4 in H2O |
| Water Solubility | within almost transparency |
| Sensitive | Hygroscopic |
| BRN | 1723080 |
| InChI | 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5+/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-VVZXFQNISA-N |
| SMILES | O[C@H]1COC(O)[C@@H](O)[C@@H]1O |
| LogP | -2.390 (est) |
| CAS DataBase Reference | 609-06-3(CAS DataBase Reference) |
| EPA Substance Registry System | L-Xylose (609-06-3) |
Description and Uses
L-Xylose is used in the synthesis of L-Xylose derivatives as selective sodium-dependent glucose cotransporter 2 (SGLT2) inhibitors for the treatment of type 2 diabetes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |







