A7636558
Protirelin , 10mMinDMSO , 24305-27-9
Synonym(s):
TRH;PIN2;TRF;TRF1;TERF1
CAS NO.:24305-27-9
Empirical Formula: C16H22N6O4
Molecular Weight: 362.38
MDL number: MFCD00038640
EINECS: 246-143-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >143°C (dec.) |
| Boiling point: | 494°C (rough estimate) |
| alpha | -50 (D/25℃) (c=1.5, H2O)-65.5 (D) (c=1.0, H2O) |
| Density | 1.1675 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | −20°C |
| solubility | H2O: 10 mg/mL, clear, colorless |
| pka | 13.05±0.20(Predicted) |
| form | powder |
| color | White to Off-White |
| PH | pH (10g/l, 25℃) : 3.0~4.0 |
| biological source | mouse |
| Water Solubility | water: 25mg/mL, cloudy, colorless to faintly yellow |
| Merck | 13,9663 |
| BRN | 770238 |
| Sequence | {pGlu}-His-Pro-NH2 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | ITYONPBTNRIEBA-SRVKXCTJSA-N |
| SMILES | NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc2c[nH]cn2)NC(=O)[C@@H]3CCC(=O)N3 |
| CAS DataBase Reference | 24305-27-9 |
Description and Uses
The first hypothalamic hypophysiotropic neurohormone identified, TRH consists of the tripeptide pGlu-His-ProNH2. It stimulates the secretion ofthyroid-stimulating hormone (TSH), prolactin (PRL), and growth hormone (GH), and also functions as a neurotransmitter and neuromodulator.
prothyrotropin
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | TW3580000 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |







