A0937512
Ala-Pro hydrate , 96% , 13485-59-1
CAS NO.:13485-59-1
Empirical Formula: C8H14N2O3
Molecular Weight: 186.21
MDL number: MFCD00037332
EINECS: 236-795-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB69.60 | In Stock |
|
| 1G | RMB177.60 | In Stock |
|
| 5g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-178 °C |
| Boiling point: | 403.8±40.0 °C(Predicted) |
| Density | 1.294±0.06 g/cm3(Predicted) |
| refractive index | -112 ° (C=2, H2O) |
| storage temp. | -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 3.19±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | -104.6°(C=1.16g/100mL , H2O, 20°C, 589nm) |
| Water Solubility | within almost transparency |
| BRN | 3546017 |
| InChI | 1S/C8H14N2O3.H2O/c1-5(9)7(11)10-4-2-3-6(10)8(12)13;/h5-6H,2-4,9H2,1H3,(H,12,13);1H2/t5-,6-;/m0./s1 |
| InChIKey | SSUWZOPYGFOQJA-GEMLJDPKSA-N |
| SMILES | O.C[C@H](N)C(=O)N1CCC[C@H]1C(O)=O |
| CAS DataBase Reference | 13485-59-1(CAS DataBase Reference) |
Description and Uses
L-Alanyl-L-proline is a dipeptide that contains a sterically constrained proline, a well-known turn inducer in proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |






