PRODUCT Properties
| Boiling point: | 487.6±45.0 °C(Predicted) |
| Density | 1.222 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 3.41±0.10(Predicted) |
| color | White to off-white |
| optical activity | 36.6°(C=0.01978g/mL, H2O , 20°C, 589nm) |
| InChI | 1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | OMNVYXHOSHNURL-WPRPVWTQSA-N |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(O)=O |
| CAS DataBase Reference | 3061-90-3(CAS DataBase Reference) |
Description and Uses
Alanylphenylalanine is a potential antitumor agent that targets DNA via metal coordination. The complex of Alanylphenylalanine and Au (III) can bind to DNA and inhibit tumor cell proliferation[1][2].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
