A0725412
L-Alanine 4-nitroanilide hydrochloride , 99% , 31796-55-1
Synonym(s):
Ala-4-nitroanilide;H-Ala-pNA
CAS NO.:31796-55-1
Empirical Formula: C9H12ClN3O3
Molecular Weight: 245.66
MDL number: MFCD00039088
EINECS: 250-811-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB223.20 | In Stock |
|
| 1G | RMB583.20 | In Stock |
|
| 5G | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL, clear, yellow |
| form | Powder |
| color | Pale yellow |
| Water Solubility | water: 50mg/mL, clear to very slightly hazy |
| BRN | 6303731 |
| InChI | 1S/C9H11N3O3.ClH/c1-6(10)9(13)11-7-2-4-8(5-3-7)12(14)15;/h2-6H,10H2,1H3,(H,11,13);1H/t6-;/m0./s1 |
| InChIKey | YEXRLSXNWLNHQR-RGMNGODLSA-N |
| SMILES | Cl[H].C[C@H](N)C(=O)Nc1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 31796-55-1(CAS DataBase Reference) |
Description and Uses
L-Alanine 4-nitroanilide hydrochloride has been used to determine the activity of aminopeptidase in the intestinal segments and small intestine (jejunum and ileum).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |







