N-Succinimidyl4-(N-Maleimidomethyl)cyclohexanecarboxylate , 10mMinDMSO , 64987-85-5
Synonym(s):
N-Succinimidyl 4-(maleimidomethyl)cyclohexanecarboxylate;SMCC;Succinimidyl- trans-4-(N-maleimidylmethyl)cyclohexane-1-carboxylate;Succinimidyl-trans-4-(N-maleimidylmethyl)cyclohexane-1-carboxylate
CAS NO.:64987-85-5
Empirical Formula: C16H18N2O6
Molecular Weight: 334.32
MDL number: MFCD00009634
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 180-182 °C (lit.) |
| Boiling point: | 501.7±42.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | chloroform: 50 mg/mL |
| form | powder |
| pka | -2.24±0.20(Predicted) |
| color | White to Off-White |
| Sensitive | Moisture & Light Sensitive |
| BRN | 1555271 |
| InChI | InChI=1S/C16H18N2O6/c19-12-5-6-13(20)17(12)9-10-1-3-11(4-2-10)16(23)24-18-14(21)7-8-15(18)22/h5-6,10-11H,1-4,7-9H2 |
| InChIKey | JJAHTWIKCUJRDK-UHFFFAOYSA-N |
| SMILES | C1(C(ON2C(=O)CCC2=O)=O)CCC(CN2C(=O)C=CC2=O)CC1 |
| CAS DataBase Reference | 64987-85-5(CAS DataBase Reference) |
Description and Uses
SMCC crosslinker is a hetero-bifunctional crosslinker that contain N-hydroxysuccinimide (NHS) ester and maleimide groups that allow covalent conjugation of amine- and sulfhydryl-containing molecules. SMCC crosslinker must be dissolved in an organic solvent, such as DMSO or DMF, and then can be added to an aqueous crosslinking reaction. SMCC crosslinking reagent is permeable across the lipid bilayer of the cell membrane and can be used to crosslink intracellular proteins and peptides.
A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent. It conjugates anti-digoxin F(abTaIII)2 fragments to l-B-galactosidase. Conjugates hIgG to alkaline phosphatase.Spacer Arm: 11.6 Angstroms.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-60-37 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |





