Tropinone , 99% , 532-24-1
Synonym(s):
8-Methyl-8-azabicyclo[3.2.1]octan-3-one
CAS NO.:532-24-1
Empirical Formula: C8H13NO
Molecular Weight: 139.19
MDL number: MFCD00005549
EINECS: 208-530-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB39.20 | In Stock |
|
| 25G | RMB66.40 | In Stock |
|
| 100G | RMB230.40 | In Stock |
|
| 500g | RMB1119.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 40-44 °C(lit.) |
| Boiling point: | 113 °C25 mm Hg(lit.) |
| Density | 1.0268 (rough estimate) |
| refractive index | 1.4598 (estimate) |
| Flash point: | 194 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | crystalline |
| pka | 8.93±0.20(Predicted) |
| color | brown |
| PH | 8 (18g/l, H2O, 20℃) |
| BRN | 2329 |
| InChI | 1S/C8H13NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-7H,2-5H2,1H3/t6-,7+ |
| InChIKey | QQXLDOJGLXJCSE-KNVOCYPGSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(=O)C2 |
| CAS DataBase Reference | 532-24-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 8-Azabicyclo[3.2.1]octan-3-one, 8-methyl-(532-24-1) |
| EPA Substance Registry System | 8-Azabicyclo[3.2.1]octan-3-one, 8-methyl- (532-24-1) |
Description and Uses
Tropinone (8-methyl-8-azabicyclo[3.2.1]octane-3-one)(7) is the simplest plant tropane and is the first intermediate in the biosynthesis of tropane alkaloids. Studies have called 4-(1-methyl-2-pyrrolidinyl)-3-oxobutanoic acid as an intermediate metabolite in tropinone biosynthesis[1]. It is an intermediate of atropine sulfate and is used in the synthesis of atropine. Atropine is an anticholinergic drug. It acts as an M-blocker and is indicated for the relief of visceral colic.
Tropinone is an oxidative product of Tropane, used to synthesize Morphine and Tropane alkaloids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332 |
| Precautionary statements | P261-P264-P270-P271-P301+P312-P304+P340+P312 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C,Xi |
| Risk Statements | 34-22-36/37/38 |
| Safety Statements | 23-24/25-36/37/39-26-22 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |




