A7640612
Tropine , 98% , 120-29-6
Synonym(s):
3-Tropanol
CAS NO.:120-29-6
Empirical Formula: C8H15NO
Molecular Weight: 141.21
MDL number: MFCD00005551
EINECS: 204-384-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 10G | RMB68.80 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100G | RMB448.00 | In Stock |
|
| 500g | RMB2200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-60 °C(lit.) |
| Boiling point: | 233 °C(lit.) |
| Density | 1.045 g/mL at 25 °C(lit.) |
| refractive index | 1.4811 (estimate) |
| Flash point: | 232-234°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: 0.1 g/mL, clear |
| form | Crystalline Powder |
| pka | 3.80(at 15℃) |
| color | White to slightly yellow |
| PH | 12 (100g/l, H2O, 20℃) |
| Water Solubility | 100 g/L (20 ºC) |
| Sensitive | Hygroscopic |
| Merck | 14,9781 |
| BRN | 80188 |
| InChI | 1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+ |
| InChIKey | CYHOMWAPJJPNMW-JIGDXULJSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1C[C@H](O)C2 |
| LogP | -0.100 (est) |
| CAS DataBase Reference | 120-29-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Tropine(120-29-6) |
| EPA Substance Registry System | 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, (3-endo)- (120-29-6) |
Description and Uses
Tropine is an oxidative product of Tropane, used to synthesize alkaloid derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332 |
| Precautionary statements | P261-P264-P270-P271-P304+P340+P312-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 26/28-20/22 |
| Safety Statements | 22-24/25 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | YM3875000 |
| F | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29399990 |
| Storage Class | 11 - Combustible Solids |





![(4R,5R,6S)-4-Nitrobenzyl 3-((diphenoxyphosphoryl)oxy)-6-((R)-1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/90776-59-3.gif)
