A7638558
Genipin , 10mMinDMSO , 6902-77-8
Synonym(s):
Methyl (1S,2R,6S)-2-hydroxy-9-(hydroxymethyl)-3-oxabicyclo[4.3.0]nona-4,8-diene-5-carboxylate
CAS NO.:6902-77-8
Empirical Formula: C11H14O5
Molecular Weight: 226.23
MDL number: MFCD00888600
EINECS: 636-196-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118.0 to 123.0 °C |
| Boiling point: | 287.83°C (rough estimate) |
| Density | 1.1230 (rough estimate) |
| refractive index | 1.4720 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO: ≥25mg/mL |
| form | powder |
| pka | 12.06±0.60(Predicted) |
| color | White to Almost white |
| optical activity | 117.7° (C=0.01 g/ml, MEOH) |
| λmax | 240nm(MeOH)(lit.) |
| InChI | InChI=1S/C11H14O5/c1-15-10(13)8-5-16-11(14)9-6(4-12)2-3-7(8)9/h2,5,7,9,11-12,14H,3-4H2,1H3/t7-,9-,11-/m1/s1 |
| InChIKey | AZKVWQKMDGGDSV-BCMRRPTOSA-N |
| SMILES | [C@@H]1(O)OC=C(C(OC)=O)[C@@]2([H])CC=C(CO)[C@@]12[H] |
| CAS DataBase Reference | 6902-77-8(CAS DataBase Reference) |
Description and Uses
Genipin has been used:
- in chemosensitivity assay
- in the preparation of recombinant human (rh)-odontogenic ameloblast-associated protein (ODAM) -impregnated collagen gel and in vitro mineralization assay
- in genipin gel preparation
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 3/14-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GY5828000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29329990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





