PRODUCT Properties
| Melting point: | melting at 216° |
| alpha | D30 +56.6° |
| Boiling point: | 657.1±55.0 °C(Predicted) |
| Density | 1.51±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly) |
| form | Solid |
| pka | 12.90±0.70(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | food and beverages |
| InChIKey | HXCGUCZXPFBNRD-VPVUCYOBNA-N |
| SMILES | C([C@@H]1OC2=CC3OC(=O)C=CC=3C=C2C1)(C)(C)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O |&1:1,18,19,20,22,24,r| |
Description and Uses
Nodakenin is a compound used for inhibiting influenza virus including Nodakenin and/or Nodakenetin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





