A7638712
2,3,3-Trimethylindolenine , 98% , 1640-39-7
Synonym(s):
2,3,3-Trimethyl-3H-indole
CAS NO.:1640-39-7
Empirical Formula: C11H13N
Molecular Weight: 159.23
MDL number: MFCD00005724
EINECS: 216-685-6
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB31.20 | In Stock |
|
| 25ML | RMB95.20 | In Stock |
|
| 100ML | RMB302.40 | In Stock |
|
| 500ML | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6-8°C |
| Boiling point: | 228-229 °C744 mm Hg(lit.) |
| Density | 0.992 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 200 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform, toluene or dichlorobenzene. |
| pka | 6.33±0.40(Predicted) |
| form | Liquid |
| color | Clear yellow to red-brown |
| BRN | 119740 |
| InChI | InChI=1S/C11H13N/c1-8-11(2,3)9-6-4-5-7-10(9)12-8/h4-7H,1-3H3 |
| InChIKey | FLHJIAFUWHPJRT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C)(C)C=1C |
| CAS DataBase Reference | 1640-39-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 3H-Indole, 2,3,3-trimethyl-(1640-39-7) |
| EPA Substance Registry System | 3H-Indole, 2,3,3-trimethyl- (1640-39-7) |
Description and Uses
2,3,3-Trimethylindolenine is an indole derivative used in the preparation of cyanine dye labelleing reagents and other imaging agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 1 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





