PRODUCT Properties
| Melting point: | 149-152 °C(lit.) |
| alpha | 47.5 º (c=2, water) |
| Boiling point: | 364.51°C (rough estimate) |
| Density | 1.2446 (rough estimate) |
| refractive index | 1.4960 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: soluble25mg/mL |
| form | Crystalline |
| pka | 3.15±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | Soluble in water (25 mg/ml), and ethanol. |
| BRN | 2697172 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | SKIN CONDITIONING TANNING |
| Cosmetic Ingredient Review (CIR) | N-Acetyl-L-tyrosine (537-55-3) |
| InChI | 1S/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16)/t10-/m0/s1 |
| InChIKey | CAHKINHBCWCHCF-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(O)=O |
| LogP | 1.320 |
| CAS DataBase Reference | 537-55-3(CAS DataBase Reference) |
| NIST Chemistry Reference | N-acetyl-Tyr(537-55-3) |
| EPA Substance Registry System | N-Acetyl-L-tyrosine (537-55-3) |
Description and Uses
N-Acetyl-L-tyrosine is involved in catecholamine production. It can be used as a cell culture media component in the commercial biomanufacture of therapeutic recombinant proteins and monoclonal antibodies.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280i-P310a-P280-P305+P351+P338+P310-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 41-36/37/38 |
| Safety Statements | 26-39-36 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29242995 |
| Storage Class | 11 - Combustible Solids |





