A7639512
3-(Tritylthio)propionic acid , 97% , 27144-18-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB122.40 | In Stock |
|
| 100G | RMB463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-213°C |
| Boiling point: | 503.8±38.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Soluble), Methanol (Slightly) |
| pka | 4.59±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| Water Solubility | Partly miscible in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C22H20O2S/c23-21(24)16-17-25-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2,(H,23,24) |
| InChIKey | AECGEIVNZGQBJT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCSC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 27144-18-9(CAS DataBase Reference) |
Description and Uses
Preparation and structural modification of 3-Tritylsulfanylpropionic Acid possesses antileukemic activity against leukemia.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H413 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






