A7641512
trans-4-(Trifluoromethyl)cinnamic acid , 98% , 16642-92-5
CAS NO.：16642-92-5
Empirical Formula: C10H7F3O2
Molecular Weight: 216.16
MDL number: MFCD00002696
EINECS: 605-440-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB123.20 | In Stock |
|
| 100G | RMB459.20 | In Stock |
|
| 500g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-233 °C(lit.) |
| Boiling point: | 279.2±35.0 °C(Predicted) |
| Density | 1.3275 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 4.21±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2452800 |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)8-4-1-7(2-5-8)3-6-9(14)15/h1-6H,(H,14,15)/b6-3+ |
| InChIKey | ANRMAUMHJREENI-ZZXKWVIFSA-N |
| SMILES | C(O)(=O)/C=C/C1=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 16642-92-5(CAS DataBase Reference) |
Description and Uses
trans-4-(Trifluoromethyl)cinnamic acid has been employed as internal standard for the determination of A77 1726 (2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]-2-butenamide) in plasma by HPLC.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
