A7881712
4-(Trifluoromethyl)benzenesulfonamide , ≥98.0% , 830-43-3
CAS NO.:830-43-3
Empirical Formula: C7H6F3NO2S
Molecular Weight: 225.19
MDL number: MFCD00159251
EINECS: 212-596-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100g | RMB623.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-180 °C(lit.) |
| Boiling point: | 304.8±52.0 °C(Predicted) |
| Density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.68±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2695323 |
| InChI | InChI=1S/C7H6F3NO2S/c8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h1-4H,(H2,11,12,13) |
| InChIKey | TVHXQQJDMHKGGK-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 830-43-3(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethyl)benzenesulfonamide is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37-26 |
| WGK Germany | 3 |
| RTECS | DB3200000 |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |







