A7642012
p-Tolyl disulfide , 98% , 103-19-5
CAS NO.：103-19-5
Empirical Formula: C14H14S2
Molecular Weight: 246.39
MDL number: MFCD00008547
EINECS: 203-087-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB219.20 | In Stock |
|
| 100G | RMB730.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-46 °C (lit.) |
| Boiling point: | 349.4°C (rough estimate) |
| Density | 1.2475 (rough estimate) |
| refractive index | 1.6210 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | TZOVOULUMXXLOJ-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C(C)C=C1)SC1=CC=C(C)C=C1 |
| LogP | 5.400 |
| CAS DataBase Reference | 103-19-5(CAS DataBase Reference) |
| EPA Substance Registry System | Disulfide, bis(4-methylphenyl) (103-19-5) |
Description and Uses
4-Methylphenyl Disulfide can be useful in electrochemical regioselective C(sp2)-H selenylation and sulfenylation of substituted 2-amino-1,4-naphthoquinones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-16 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| RTECS | JO1526250 |
| TSCA | T |
| HS Code | 29309090 |
