A7642612
2,3,5-Tribromothiophene , 98% , 3141-24-0
CAS NO.：3141-24-0
Empirical Formula: C4HBr3S
Molecular Weight: 320.83
MDL number: MFCD00014521
EINECS: 221-544-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB879.20 | In Stock |
|
| 250g | RMB2527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-28 °C (lit.) |
| Boiling point: | 120 °C/11 mmHg (lit.) |
| Density | 2.483 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | solid |
| Specific Gravity | 2.483 |
| color | White or Colorless to Yellow |
| BRN | 111486 |
| InChI | InChI=1S/C4HBr3S/c5-2-1-3(6)8-4(2)7/h1H |
| InChIKey | SKDNDSLDRLEELJ-UHFFFAOYSA-N |
| SMILES | C1(Br)SC(Br)=CC=1Br |
| CAS DataBase Reference | 3141-24-0(CAS DataBase Reference) |
| EPA Substance Registry System | Thiophene, 2,3,5-tribromo- (3141-24-0) |
Description and Uses
2,3,5-Tribromothiophene was used in the synthesis of 2,5-bis(dicyanomethylene)-3-bromo-2,5-dihydrothiophene.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H331-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37/39-26 |
| RIDADR | UN 2929 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | T |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| HS Code | 29349990 |
