PRODUCT Properties
| Melting point: | 76-79 °C(lit.) |
| Boiling point: | 142 °C125 mm Hg(lit.) |
| Density | 1.1603 (rough estimate) |
| refractive index | 1.5120 (estimate) |
| Flash point: | 142°C/125mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 95% ethanol: soluble5%, clear to very slightly hazy, colorless to light yellow |
| pka | 10.97±0.41(Predicted) |
| form | Powder |
| color | White to light yellow or pinkish |
| Water Solubility | Partly miscible with water. |
| BRN | 1854721 |
| InChI | 1S/C8H6O2.H2O/c9-6-8(10)7-4-2-1-3-5-7;/h1-6H;1H2 |
| InChIKey | YQBLQKZERMAVDO-UHFFFAOYSA-N |
| SMILES | [H]O[H].[H]C(=O)C(=O)c1ccccc1 |
| CAS DataBase Reference | 1075-06-5(CAS DataBase Reference) |
Description and Uses
Phenylglyoxal monohydrate was used to modify pig muscle carbonic anhydraseIII and as a specific reagent for arginine groups. It was also used to prepare pyrrolinone and furan derivatives and as as a chemiluminescent reagent for the determination of purines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| RTECS | MD3260000 |
| HS Code | 2914.40.4000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LD50,oral,500mg/kg (500mg/kg),Journal of Medicinal and Pharmaceutical Chemistry. Vol. 1, Pg. 365, 1959. |






