A6248112
5-Nitroisatin , ≥98.0%(HPLC) , 611-09-6
Synonym(s):
5-Nitroindole-2,3-dione;5-Nitrosotin;NSC 525798
CAS NO.：611-09-6
Empirical Formula: C8H4N2O4
Molecular Weight: 192.13
MDL number: MFCD00005720
EINECS: 210-252-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB233.60 | In Stock |
|
| 100G | RMB976.00 | In Stock |
|
| 500g | RMB3359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 251 °C (dec.) (lit.) |
| Boiling point: | 328.09°C (rough estimate) |
| Density | 1.5513 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.06±0.20(Predicted) |
| form | Crystalline Powder |
| color | Orange-yellow to orange |
| BRN | 180223 |
| InChI | InChI=1S/C8H4N2O4/c11-7-5-3-4(10(13)14)1-2-6(5)9-8(7)12/h1-3H,(H,9,11,12) |
| InChIKey | UNMYHYODJHKLOC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C([N+]([O-])=O)C=C2)C(=O)C1=O |
| CAS DataBase Reference | 611-09-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-indole-2,3-dione, 5-nitro-(611-09-6) |
Description and Uses
Reactant for preparation of:
- Potential antibacterial and antifungal agents
- spiro[indole-thiazolidinones] as a medicinally important scaffold
- Potential antimycobacterial agents
- Anticonvulsant agents
- Inhibitors of human transglutaminase 2
- Anthelmintic agents
- Anti-human immunodeficiency virus (HIV) agents
- Antimicrobial agents
- Potential antitubercular agents
- Inhibitors of acetylcholinesterase
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H351 |
| Precautionary statements | P202-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-40-68-22 |
| Safety Statements | 7-22-36/37/39-45-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | NL7970000 |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
