PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 692.0±55.0 °C(Predicted) |
| Density | 1.72±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | almost transparency in NaOH100g/L |
| form | powder to crystal |
| pka | 9.29±0.20(Predicted) |
| color | Light yellow to Brown |
| Stability: | Light and Moisture Sensitive |
| InChI | InChI=1S/C20H11NO7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)20(15)14-4-1-10(21(25)26)7-13(14)19(24)28-20/h1-9,22-23H |
| InChIKey | UACQOMKZFGNRBL-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=C(O)C=C3)OC3=C1C=CC(O)=C3)C1=C(C=C([N+]([O-])=O)C=C1)C(=O)O2 |
| EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-5-nitro- (3326-35-0) |
Description and Uses
Fluorescent labeling reagent for proteins. 4-Nitrofluorescein is used in the fluorescent antibody technique for rapid identification of pathogens.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2932.99.7000 |




