PRODUCT Properties
| Melting point: | 146-148 °C (lit.) |
| Boiling point: | 358.84°C (rough estimate) |
| Density | 1.4330 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Stability: | Stable, but may be heat or shock sensitive. Incompatible with strong bases, strong oxidizing agents. |
| InChI | InChI=1S/C10H6N2O4/c13-11(14)8-5-7-3-1-2-4-9(7)10(6-8)12(15)16/h1-6H |
| InChIKey | ULALSFRIGPMWRS-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=C2C(C=CC=C2)=CC([N+]([O-])=O)=C1 |
| EPA Substance Registry System | 1,3-Dinitronaphthalene (606-37-1) |
Description and Uses
Dinitronaphthalene is a yellowish crystallinesolid. Molecular weight= 218.18; Freezing/Melting points:(1,3-) 146148℃; (1,5-) 218℃; (1,8-) 173℃. These substances are highly flammable, potentially explosive; shockand heat sensitive.
1,3-Dinitronaphthalene was used to study the photocatalytic oxidation reaction of 1,3-dinitronaphthalene in the presence of TiO(2) Degussa (P-25 grade).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | QJ4550800 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






