A7643512
Tetrabutylphosphonium chloride , 96% , 2304-30-5
CAS NO.:2304-30-5
Empirical Formula: C16H36ClP
Molecular Weight: 294.88
MDL number: MFCD00011854
EINECS: 218-964-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB46.40 | In Stock |
|
| 10G | RMB72.80 | In Stock |
|
| 25g | RMB158.40 | In Stock |
|
| 50G | RMB234.40 | In Stock |
|
| 100g | RMB438.40 | In Stock |
|
| 250g | RMB928.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-66 °C (dec.) (lit.) |
| Boiling point: | 344.8℃[at 101 325 Pa] |
| Density | 0.978[at 20℃] |
| vapor pressure | 0.018Pa at 25℃ |
| refractive index | 1.5 |
| Flash point: | 4°C (39°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid |
| color | colorless to pale-yellow |
| Specific Gravity | 0.91 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4019186 |
| Stability: | Hygroscopic |
| InChI | 1S/C16H36P.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IBWGNZVCJVLSHB-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCC[P+](CCCC)(CCCC)CCCC |
| LogP | -0.44 at 23℃ |
| CAS DataBase Reference | 2304-30-5(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonium, tetrabutyl-, chloride (2304-30-5) |
Description and Uses
Tetrabutylphosphonium Chloride functions as inhibitor of bovine serum amine oxidase.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H310+H330-H314 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 22-24-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | TA2419000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9051 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1C Skin Sens. 1B |








