A7784412
Tetrabutylphosphonium hydroxide solution , 40wt.%inH2O , 14518-69-5
Synonym(s):
TBPH
CAS NO.:14518-69-5
Empirical Formula: C16H37OP
Molecular Weight: 276.44
MDL number: MFCD00068456
EINECS: 238-528-0
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.989 g/mL at 25 °C |
| refractive index | n |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 0.989 |
| Water Solubility | Miscible with water. |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| BRN | 4826225 |
| InChI | InChI=1S/C16H36P.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | DFQPZDGUFQJANM-UHFFFAOYSA-M |
| SMILES | [P+](CCCC)(CCCC)(CCCC)CCCC.[OH-] |
| CAS DataBase Reference | 14518-69-5(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonium, tetrabutyl-, hydroxide (1:1) (14518-69-5) |
Description and Uses
Tetrabutylphosphonium Hydroxide is a phase transfer catalyst for the etherification of thiosalicylic acid and analogs. Tetrabutylphosphonium Hydroxide is a pretreatment for rice husks that enhances enzymic and acid hydrolysis yields. Tetrabutylphosphonium Hydroxide is used in the synthesis of tetrabutylphosphonium carboxylate as a recyclable and highly selective catalysts for alcoholysis reaction of propylene oxide.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | - |
| F | 10-34 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319019 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





