A7645112
4,4',4-Trimethyltriphenylamine , 98% , 1159-53-1
Synonym(s):
N ,N ,N -Tri(4-methylphenyl)amine;Tri(4-methylphenyl)amine;Tri-4-tolylamine;Tritolylamine
CAS NO.:1159-53-1
Empirical Formula: C21H21N
Molecular Weight: 287.4
MDL number: MFCD00674043
EINECS: 214-595-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB248.00 | In Stock |
|
| 100G | RMB729.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-118°C |
| Boiling point: | 170 °C / 0.1mmHg |
| Density | 1.10 g/cm3 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in chloroform and tetrahydrofuran (THF). |
| pka | -1.76±0.50(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C21H21N/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | YXYUIABODWXVIK-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C(C)C=C2)C2=CC=C(C)C=C2)=CC=C(C)C=C1 |
| CAS DataBase Reference | 1159-53-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4-methyl-N,N-bis(4-methylphenyl)- (1159-53-1) |
Description and Uses
Used for proteomics research. Also employed as a intermediate for pharmaceutical.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29214990 |







