A7645212
Trihydroxyethylrutin , 97% , 7085-55-4
Synonym(s):
3′,4′,7-Tris[O-(2-hydroxyethyl)]rutin;Trihydroxyethylrutin;Troxerutin
CAS NO.:7085-55-4
Empirical Formula: C33H42O19
Molecular Weight: 742.68
MDL number: MFCD00893813
EINECS: 230-389-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB122.40 | In Stock |
|
| 25G | RMB446.40 | In Stock |
|
| 250G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181°C |
| Boiling point: | 1058.4±65.0 °C(Predicted) |
| Density | 1.65±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Freely soluble in water, slightly soluble in ethanol (96 per cent) and practically insoluble in methylene chloride. |
| form | Solid |
| pka | 5.92±0.40(Predicted) |
| color | Light Yellow to Yellow |
| Merck | 14,9789 |
| BRN | 4778232 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | KMPBUGGPUQOWMJ-NXPSPVSKSA-N |
| SMILES | O1[C@H]([C@@H]([C@@H]([C@H]([C@@H]1C)O)O)O)OC[C@H]2O[C@H]([C@@H]([C@H]([C@@H]2O)O)O)Oc3[c](c4c([o]c3c5cc(c(cc5)OCCO)OCCO)cc(cc4O)OCCO)=O |
| CAS DataBase Reference | 7085-55-4(CAS DataBase Reference) |
Description and Uses
vasoprotectant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LK8331500 |
| HS Code | 2938100000 |
| Storage Class | 11 - Combustible Solids |




