Vitamin K1 , 98%(sumofCis-trans) , 84-80-0
Synonym(s):
Phytomenadione;Phylloquinone;3-Phytylmenadione;2-Methyl-3-phytyl-1,4-naphthoquinone;Vitamin K? (phytomenadione)
CAS NO.:84-80-0
Empirical Formula: C31H46O2
Molecular Weight: 450.7
MDL number: MFCD00214063
EINECS: 201-564-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB128.00 | In Stock |
|
| 25G | RMB530.40 | In Stock |
|
| 100g | RMB2112.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | −20 °C(lit.) |
| Boiling point: | 140°C 0mm |
| alpha | D25 -0.28° (dioxane) |
| Density | 0.984 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Dioxane (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | viscous liquid |
| Specific Gravity | 0.984 |
| color | Yellow to Dark Yellow |
| Odor | odorless |
| biological source | synthetic (organic inorganic) |
| Water Solubility | Miscible with dehydrated alcohol, acetone, petroleum ether, hexane, dioxane, chloroform, ether, benzene and vegetable oils. Immiscible with water. |
| Sensitive | Light Sensitive |
| Merck | 14,7380 |
| BRN | 2568816 |
| Stability: | Light Sensitive |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS |
| InChIKey | MBWXNTAXLNYFJB-LKUDQCMESA-N |
| SMILES | O=C(C1=CC=CC=C21)C(C)=C(C/C=C(CCC[C@@H](CCC[C@H](C)CCCC(C)C)C)\C)C2=O |
| LogP | 10.305 (est) |
| CAS DataBase Reference | 84-80-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Phytonadione(84-80-0) |
| EPA Substance Registry System | Phylloquinone (84-80-0) |
Description and Uses
Vitamin K1 is a fat-soluble, dietary nutrient that is essential for the synthesis of proteins important for blood-clotting, bone metabolism, and cell growth. It is found in the photosynthetic tissues of green, leafy plants, where it acts as an electron acceptor forming part of the electron transport chain of Photosystem I. Vitamin K1 also serves as a precursor to vitamin K2 and is reported to exhibit anticancer activity in various cell lines.
Labeled Phytonadione, intended for use as an internal standard for the quantification of Phytonadione by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P280-P305+P351+P338-P337+P313-P403+P235 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| WGK Germany | 2 |
| RTECS | QJ5800000 |
| F | 1-8-10 |
| TSCA | TSCA listed |
| HS Code | 29362900 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 84-80-0(Hazardous Substances Data) |






