A7646112
4-(Trifluoromethyl)thiobenzamide , 98% , 72505-21-6
CAS NO.：72505-21-6
Empirical Formula: C8H6F3NS
Molecular Weight: 205.2
MDL number: MFCD00051806
EINECS: 673-951-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB194.40 | In Stock |
|
| 100g | RMB663.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-137 °C |
| Boiling point: | 246.0±50.0 °C(Predicted) |
| Density | 1.372±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 12.04±0.29(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| Sensitive | Stench |
| BRN | 4672885 |
| InChI | InChI=1S/C8H6F3NS/c9-8(10,11)6-3-1-5(2-4-6)7(12)13/h1-4H,(H2,12,13) |
| InChIKey | IPRFNMJROWWFBH-UHFFFAOYSA-N |
| SMILES | C1(C(N)=S)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 72505-21-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(Trifluoromethyl)thiobenzamide(72505-21-6) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H331-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37/39-26-22-36 |
| RIDADR | 2811 |
| Hazard Note | Irritant/Stench |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
