A7646412
trans-2-Nitrocinnamic acid , 98% , 612-41-9
Synonym(s):
trans-3-(2-Nitrophenyl)acrylic acid
CAS NO.:612-41-9
Empirical Formula: C9H7NO4
Molecular Weight: 193.16
MDL number: MFCD00007189
EINECS: 210-309-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB69.60 | In Stock |
|
| 25G | RMB205.60 | In Stock |
|
| 100G | RMB703.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-245 °C(lit.) |
| Boiling point: | 329.36°C (rough estimate) |
| Density | 1.4058 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystals |
| pka | pK1:4.15 (25°C) |
| Appearance | Light yellow to yellow Solid |
| Water Solubility | insoluble |
| BRN | 2211209 |
| InChI | 1S/C9H7NO4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H,(H,11,12)/b6-5+ |
| InChIKey | BBQDLDVSEDAYAA-AATRIKPKSA-N |
| SMILES | OC(=O)\C=C\c1ccccc1[N+]([O-])=O |
| CAS DataBase Reference | 612-41-9(CAS DataBase Reference) |
| NIST Chemistry Reference | trans-2-Nitrocinnamic acid(612-41-9) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | UD3642850 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD,intraperitoneal,> 350mg/kg (350mg/kg),BEHAVIORAL: CHANGES IN MOTOR ACTIVITY (SPECIFIC ASSAY)BEHAVIORAL: REGIDITYBEHAVIORAL: ATAXIA,Indian Journal of Pharmaceutical Sciences. Vol. 49, Pg. 77, 1987. |






