PRODUCT Properties
| Melting point: | 87-89 °C(lit.) |
| Boiling point: | 275.0±40.0 °C(Predicted) |
| Density | 1.2773 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.66±0.10(Predicted) |
| form | Solid |
| color | Brown |
| BRN | 2966748 |
| InChI | InChI=1S/C7H7F3N2/c8-7(9,10)4-1-5(11)3-6(12)2-4/h1-3H,11-12H2 |
| InChIKey | KZSXRDLXTFEHJM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C(F)(F)F)=CC(N)=C1 |
| CAS DataBase Reference | 368-53-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Benzeneamine, 5-[(trifluoromethyl)- (368-53-6) |
Description and Uses
5-(Trifluoromethyl)-1,3-phenylenediamine was used in the synthesis of:
- hybrid materials based on new polyhedral oligomeric silsesquioxane
- fluorinated aromatic polyimide films
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| RTECS | CZ1606000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| HS Code | 2921511990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |








