A7648812
1,1,2,2-Tetrachloroethane , D,99.6% , 33685-54-0
Synonym(s):
1,1,2,2-Tetrachloroethane-D2;1,2-Dideutero-1,1,2,2-tetrachloroethane;Acetylene tetrachloride, 1,2-Dideutero-1,1,2,2-tetrachloroethane
CAS NO.:33685-54-0
Empirical Formula: C2H2Cl4
Molecular Weight: 167.84
MDL number: MFCD00037672
EINECS: 251-634-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB108.80 | In Stock |
|
| 2×0.5ml | RMB215.20 | In Stock |
|
| 5G | RMB367.20 | In Stock |
|
| 10×0.5ML | RMB789.60 | In Stock |
|
| 25G | RMB1428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -44°C |
| Melting point: | -44°C |
| Boiling point: | 146,5°C |
| Boiling point: | 145-146 °C737 mm Hg(lit.) |
| Density | 1.62 g/mL at 25 °C(lit.) |
| Density | d = 1,62 |
| vapor pressure | 6.6 hPa (20 °C) |
| refractive index | n |
| Flash point: | 147°C |
| storage temp. | Storage temperature: no restrictions. |
| solubility | 3g/l |
| form | Liquid |
| Specific Gravity | 1.62 |
| color | Colorless |
| Water Solubility | Slightly soluble in water. Soluble in ether, chloroform, ethanol, tetrachloromethane, methanol, acetone, petroleum spirit, carbon disulfide, dimethyl formamide and benzene. |
| BRN | 1699903 |
| Stability: | Volatile |
| InChI | 1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H/i1D,2D |
| InChIKey | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| SMILES | ClC(Cl)(C(Cl)(Cl)[2H])[2H] |
| CAS DataBase Reference | 33685-54-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1,1,2,2-Tetrachloroethane-d2 (33685-54-0) |
Description and Uses
Isotope labelled 1,1,2,2-Tetrachloroethane is a material used in the manufacturing of thermoelectric material including carbon nanotubes. It was primarily used as a solvent however due to toxicity it is no longer a viable compound.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H310+H330-H411 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+,N |
| Risk Statements | 26/27-51/53 |
| Safety Statements | 38-45-61 |
| RIDADR | UN 1702 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 2845 90 10 |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1B - Non-combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Aquatic Chronic 2 |




