PRODUCT Properties
| Melting point: | -84 °C |
| Melting point: | -95°C |
| Boiling point: | 110,6°C |
| Boiling point: | 110 °C(lit.) |
| Density | 0.943 g/mL at 25 °C(lit.) |
| Density | d = 0,94 |
| refractive index | n |
| Flash point: | 50 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 0.94 |
| explosive limit | 1.2-8.0%(V) |
| Water Solubility | Soluble in water.0.5 g/L (20°C) |
| BRN | 1909300 |
| Exposure limits | ACGIH: TWA 20 ppm OSHA: Ceiling 300 ppm; TWA 200 ppm NIOSH: IDLH 500 ppm; TWA 100 ppm(375 mg/m3); STEL 150 ppm(560 mg/m3) |
| Stability: | Stable, but may be moisture sensitive. Highly flammable. |
| InChI | 1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i1D3,2D,3D,4D,5D,6D |
| InChIKey | YXFVVABEGXRONW-JGUCLWPXSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 2037-26-5(CAS DataBase Reference) |
| EPA Substance Registry System | Toluene-d8 (2037-26-5) |
Description and Uses
Toluene-d8 can be used as solvent to study the nuclear magnetic resonance spectra of the corresponding polymethylene block copolymers.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H361d-H373 |
| Precautionary statements | P202-P210-P233-P301+P310-P303+P361+P353-P331 |
| target organs | Central nervous system |
| Hazard Codes | F,Xn,T |
| Risk Statements | 11-38-48/20-63-65-67-39/23/24/25-23/24/25 |
| Safety Statements | 36/37-46-62-45-16-7 |
| RIDADR | UN 1294 3/PG 2 |
| WGK Germany | 1 |
| F | 10 |
| Autoignition Temperature | 480℃ |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Flam. Liq. 2 Repr. 2 Skin Irrit. 2 STOT RE 2 Inhalation STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








