PRODUCT Properties
| Melting point: | -93 °C (lit.) |
| Boiling point: | 110 °C (lit.) |
| Density | 0.912 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 40 °F |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | 1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i2D,3D,4D,5D,6D |
| InChIKey | YXFVVABEGXRONW-VIQYUKPQSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(C)c([2H])c1[2H] |
| CAS Number Unlabeled | 108-88-3 |
Description and Uses
Toluene-d8 is the isotope labelled analogue of Toluene (T535870), an aromatic hydrocarbon and the mono-substituted derivative of benzene. Toluene is widely used in industry as an building block for pharmaceutical goods and as well as an organic solvent in synthetic preparations. Toluene can also be used as an octane booster in gasoline fuels in internal combustion engines and as jet fuel surrogate.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H361d-H373-H412 |
| Precautionary statements | P201-P210-P273-P301+P310-P303+P361+P353-P331 |
| target organs | Central nervous system |
| Hazard Codes | F,Xn |
| Risk Statements | 11-38-48/20-63-65-67 |
| Safety Statements | 36/37-46-62 |
| RIDADR | UN 1294 3/PG 2 |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Flam. Liq. 2 Repr. 2 Skin Irrit. 2 STOT RE 2 Inhalation STOT SE 3 |
