PRODUCT Properties
| Melting point: | 70-72 °C (lit.) |
| Flash point: | 110 °C |
| Stability: | Stable. Combustible. |
| InChI | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | ZUOUZKKEUPVFJK-LHNTUAQVSA-N |
| SMILES | C1(=C([2H])C(=C([2H])C([2H])=C1[2H])[2H])C1C([2H])=C(C([2H])=C([2H])C=1[2H])[2H] |
| CAS DataBase Reference | 1486-01-7 |
| EPA Substance Registry System | Biphenyl-d12 (1486-01-7) |
Description and Uses
1,1?-Diphenyl-D10 is a labelled analogue of 1,1?-Diphenyl .
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H410 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 23-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HS Code | 28459000 |
