S5773349
Benzylchloride-d7 , 98atom%D , 59502-05-5
Synonym(s):
α-Chlorotoluene-d7
CAS NO.：59502-05-5
Empirical Formula: C7ClD7
Molecular Weight: 133.63
MDL number: MFCD00000891
EINECS: 261-790-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2552.89 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -43 °C(lit.) |
| Boiling point: | 177-181 °C(lit.) |
| Density | 1.160 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 165 °F |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | Oil |
| color | Colourless |
| InChI | 1S/C7H7Cl/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D,6D2 |
| InChIKey | KCXMKQUNVWSEMD-XZJKGWKKSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])Cl |
| CAS DataBase Reference | 59502-05-5 |
| CAS Number Unlabeled | 100-44-7 |
Description and Uses
- Acid-catalyzed reactions requiring deuterated Acid
- NMR solvent preparation with precise pH control
- Isotope exchange studies in organic synthesis
- Chlorination reaction mechanism studies
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H331-H335-H350-H373 |
| Precautionary statements | P280-P301+P312-P302+P352-P304+P340+P311-P305+P351+P338-P308+P313 |
| target organs | Heart,forestomach, Respiratory system |
| Hazard Codes | T |
| Risk Statements | 22-23-37/38-40-41-48/22-45 |
| Safety Statements | 36/37-38-45-53 |
| RIDADR | UN 1738 6.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Carc. 1B Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 Oral STOT SE 3 |
