A7649512
Tetraethylammonium nitrate , 98% , 1941-26-0
CAS NO.:1941-26-0
Empirical Formula: C8H20N2O3
Molecular Weight: 192.26
MDL number: MFCD00041978
EINECS: 217-725-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB124.80 | In Stock |
|
| 25G | RMB372.80 | In Stock |
|
| 100g | RMB1242.40 | In Stock |
|
| 500g | RMB2374.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~280 °C (dec.) |
| Boiling point: | >100 °C |
| Density | 1.029 g/mL at 25 °C |
| refractive index | 1.4450 (estimate) |
| Flash point: | >100°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| color | White |
| Specific Gravity | 1.029 |
| BRN | 3918466 |
| Stability: | Stable. Incompatible with reducing agents, combustible materials, strong oxidants. Strong oxidizer - contact with combustible material may lead to fire. |
| InChI | 1S/C8H20N.NO3/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | JTJKNAJRGLQKDZ-UHFFFAOYSA-N |
| SMILES | [O-][N+]([O-])=O.CC[N+](CC)(CC)CC |
| EPA Substance Registry System | Ethanaminium, N,N,N-triethyl-, nitrate (1941-26-0) |
Description and Uses
Tetraethylammonium nitrate can be used:
- To prepare nitronium triflate by reacting with triflic anhydride for subsequent use as a nitrating agent for benzene.
- To study the dependency of luminescence intensity of Eu3+?complexes on the nitrate anion concentration.
- To prepare the lanthanum(III) complex named (NEt4)[La(ntfa)4] by reacting with La(NO3)3·6H2O, NaOH and 4,4,4-trifluoro-1-(2-naphthyl)-1,3-butanedion.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Danger |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi,O |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 26-36-17 |
| RIDADR | UN 3139 5.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |





