A7649412
Tetramethylammonium nitrate , 98% , 1941-24-8
CAS NO.:1941-24-8
Empirical Formula: C4H12N2O3
Molecular Weight: 136.15
MDL number: MFCD00043103
EINECS: 217-723-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB172.00 | In Stock |
|
| 250g | RMB431.20 | In Stock |
|
| 500G | RMB802.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| Boiling point: | 250.42°C (rough estimate) |
| Density | 1.2844 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystalline |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water. |
| BRN | 3917260 |
| Stability: | Stable. Reacts with rust, bases, copper, strong oxidizing agents, reducing agents. |
| InChI | 1S/C4H12N.NO3/c1-5(2,3)4;2-1(3)4/h1-4H3;/q+1;-1 |
| InChIKey | QGPVYHSXZFOSRL-UHFFFAOYSA-N |
| SMILES | [O-][N+]([O-])=O.C[N+](C)(C)C |
| CAS DataBase Reference | 1941-24-8(CAS DataBase Reference) |
| EPA Substance Registry System | Methanaminium, N,N,N-trimethyl-, nitrate (1941-24-8) |
Description and Uses
Tetramethylammonium Nitrate can be used as a glycolate oxidase inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Danger |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P210-P220-P261-P264-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | O,Xi |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 17-26-36 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |






