A7650912
2-(Trimethylsilyl)phenyl trifluoromethanesulfonate , 95% , 88284-48-4
CAS NO.:88284-48-4
Empirical Formula: C10H13F3O3SSi
Molecular Weight: 298.35
MDL number: MFCD00799598
| Pack Size | Price | Stock | Quantity |
| 1G | RMB132.00 | In Stock |
|
| 5G | RMB434.40 | In Stock |
|
| 25G | RMB1724.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 70 °C/2 mmHg (lit.) |
| Density | 1.229 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 205 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.229 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C10H13F3O3SSi/c1-18(2,3)9-7-5-4-6-8(9)16-17(14,15)10(11,12)13/h4-7H,1-3H3 |
| InChIKey | XBHPFCIWRHJDCP-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(OC1=CC=CC=C1[Si](C)(C)C)(=O)=O |
Description and Uses
2-(Trimethylsilyl)phenyl trifluoromethanesulfonate may be used to generate benzyne under mild conditions of simple fluoride treatment at room temperature.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





![1,3,5-Tris[4-(trifluoromethanesulfonyloxy)-3-(trimethylsilyl)phenyl]benzene](https://img.chemicalbook.com/CAS/GIF/847925-63-7.gif)
