A7651412
2-(Trifluoromethyl)cinnamic acid , 98% , 2062-25-1
CAS NO.:2062-25-1
Empirical Formula: C10H7F3O2
Molecular Weight: 216.16
MDL number: MFCD00004381
EINECS: 218-168-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25G | RMB387.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-207 °C(lit.) |
| Boiling point: | 276.9±35.0 °C(Predicted) |
| Density | 1.363±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.22±0.10(Predicted) |
| form | solid |
| BRN | 2617007 |
| InChI | 1S/C10H7F3O2/c11-10(12,13)8-4-2-1-3-7(8)5-6-9(14)15/h1-6H,(H,14,15)/b6-5+ |
| InChIKey | AMVYAIXPAGBXOM-AATRIKPKSA-N |
| SMILES | OC(=O)\C=C\c1ccccc1C(F)(F)F |
| CAS DataBase Reference | 2062-25-1(CAS DataBase Reference) |
Description and Uses
Ionization constant and UV-spectra of 2-(trifluoromethyl)cinnamic acid has been studied.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2916.39.7900 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






