A7651812
Tetrapropylammonium chloride , 97% , 5810-42-4
Synonym(s):
TPrACl
CAS NO.：5810-42-4
Empirical Formula: C12H28ClN
Molecular Weight: 221.81
MDL number: MFCD00038729
EINECS: 227-375-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB121.60 | In Stock |
|
| 100G | RMB406.40 | In Stock |
|
| 500g | RMB1420.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-242 °C (lit.) |
| Boiling point: | 358.03°C (rough estimate) |
| Density | 0.9461 (rough estimate) |
| refractive index | 1.5868 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystals |
| color | White |
| Water Solubility | Soluble in water, acetone |
| Sensitive | Hygroscopic |
| BRN | 3567732 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| InChI | InChI=1S/C12H28N.ClH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FBEVECUEMUUFKM-UHFFFAOYSA-M |
| SMILES | [N+](CCC)(CCC)(CCC)CCC.[Cl-] |
| CAS DataBase Reference | 5810-42-4(CAS DataBase Reference) |
| EPA Substance Registry System | Tetrapropylammonium chloride (5810-42-4) |
Description and Uses
Tetra-n-propylammonium chloride is used as phase-transfer type applications.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
