A7656912
Tetrafluoroterephthalonitrile , 99% , 1835-49-0
CAS NO.：1835-49-0
Empirical Formula: C8F4N2
Molecular Weight: 200.09
MDL number: MFCD00001776
EINECS: 217-397-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5g | RMB82.40 | In Stock |
|
| 25g | RMB255.20 | In Stock |
|
| 100g | RMB945.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-199 °C (lit.) |
| Boiling point: | 243.3±40.0 °C(Predicted) |
| Density | 1.6184 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in hot methanol. |
| form | Solid |
| color | White to Light yellow |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11 |
| InChIKey | PCRSJGWFEMHHEW-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(C#N)C(F)=C1F |
| CAS DataBase Reference | 1835-49-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Benzenedicarbonitrile, 2,3,5,6-tetrafluoro-(1835-49-0) |
| EPA Substance Registry System | Tetrafluoroterephthalonitrile (1835-49-0) |
Description and Uses
Tetrafluoroterephthalonitrile can be used as a synthessi reagent primarily used to create polymers of intinsic microporosity.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38-20/21-23/24/25-36/37/39-20/21/22 |
| Safety Statements | 26-45-37/39-22-36/37/39-27 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CZ1955000 |
| Hazard Note | Toxic |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29269090 |
| Toxicity | mouse,LD50,oral,56mg/kg (56mg/kg),Journal of Medicinal Chemistry. Vol. 21, Pg. 906, 1978. |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
