A7657058
Gentiopicroside , 10mMinDMSO , 20831-76-9
Synonym(s):
(3S,4R)-4-ethenyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,6-dihydro-3H-pyrano[3,4-c]pyran-8-one;(5R,6S)-5-Ethenyl-6-(-D-glucopyranosyloxy)-5,6-dihydro-1H,3H-Pyrano[3,4-c]pyran-1-one;(5R-trans)-5-ethenyl-6-(-D-glucopyranosyloxy)-5,6-dihydro-1H,3H-pyrano[3,4-c]pyran-1-one;Gentiopicrin;NSC606402
CAS NO.:20831-76-9
Empirical Formula: C16H20O9
Molecular Weight: 356.33
MDL number: MFCD00075700
EINECS: 244-070-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191°C |
| alpha | -200 º (c=2, H2O) |
| Boiling point: | 667.8±55.0 °C(Predicted) |
| Density | 1.52±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated) |
| form | Solid |
| pka | 12.79±0.70(Predicted) |
| color | Pale Beige |
| biological source | plant (Gentiana macrophylla Pall) |
| optical activity | [α]/D -185 to -205°, c =1 in H2O |
| Water Solubility | H2O: 20mg/mL, clear |
| Stability: | Hygroscopic |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C16H20O9/c1-2-7-8-3-4-22-14(21)9(8)6-23-15(7)25-16-13(20)12(19)11(18)10(5-17)24-16/h2-3,6-7,10-13,15-20H,1,4-5H2/t7-,10-,11-,12+,13-,15+,16+/m1/s1 |
| InChIKey | DUAGQYUORDTXOR-GPQRQXLASA-N |
| SMILES | C=C[C@H]1[C@H](O[C@]2([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C3C(OCC=C31)=O |
| LogP | -3.170 (est) |
| CAS DataBase Reference | 20831-76-9(CAS DataBase Reference) |
Description and Uses
Gentiopicroside is an anticonvulsant agent present in plant extracts.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS02 |
| Signal word | Warning |
| Hazard statements | H315-H319-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P362+P364-P303+P361+P353-P332+P313-P403+P235 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |





